126210-25-1 , 6-Azido-6-deoxy-2,3-O-isopropylidene-a-L-sorbofuranose,
CAS:126210-25-1
C9H15N3O5 / 245.24
MFCD15144924
6-脱氧-6-叠氮-2,3-O-异丙叉-a-L-呋喃山梨糖,
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranose, also known as Azido-Sorbofuranose, is a compound that has attracted attention in various fields of scientific research due to its unique properties and potential applications. In this paper, we will discuss the definition, background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, and limitations and future directions of Azido-Sorbofuranose.
Synthesis and Characterization:
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose can be synthesized through a multistep process that involves the protection and deprotection of the sorbose molecule. It can also be synthesized through a one-pot reaction that utilizes a palladium-catalyzed cross-coupling reaction.
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose can be characterized using various analytical techniques such as NMR spectroscopy, IR spectroscopy, and mass spectrometry. These techniques can be used to determine the purity and structure of the compound.
Analytical Methods:
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose can be analyzed using various analytical methods such as HPLC, GC-MS, and LC-MS. These methods can be used to determine the quantity and purity of the compound in a sample.
Biological Properties:
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose has been studied for its potential biological properties such as its antitumor and antiviral activity. It has been shown to inhibit the growth of cancer cells and viruses in vitro. However, more research is needed to determine the mechanism of action and potential therapeutic applications of 6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose.
Toxicity and Safety in Scientific Experiments:
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose has not been extensively studied for its toxicity and safety in scientific experiments. However, it is important to handle this compound with care and follow appropriate safety protocols when working with it in the laboratory.
Applications in Scientific Experiments:
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose has various applications in scientific experiments. It can be used as a building block in organic synthesis reactions, as a tool in click chemistry reactions, and as a probe in biological and biochemical studies. It has also been utilized in drug discovery and materials science research.
Current State of Research:
Despite the growing interest in 6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose, there are still many areas that require further research. Currently, research is focused on determining its mechanism of action in antitumor and antiviral activity, developing new synthetic routes for the compound, and exploring its potential applications in materials science.
Potential Implications in Various Fields of Research and Industry:
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose has potential implications in various fields of research and industry. It can be utilized in the development of new drugs, the design of novel materials, and the synthesis of complex organic molecules. Its unique properties make it a valuable tool in these fields.
Limitations and Future Directions:
There are several limitations to the use of 6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose in scientific research. Its toxicity and safety profile needs to be fully characterized, and more studies are needed to determine its potential therapeutic applications. In addition, there is a need for the development of new synthetic routes for the compound, and for the exploration of its potential applications in various fields.
Future Directions:
Some potential future directions for research on 6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose include the following:
1. Determining its potential as a therapeutic agent in cancer and viral infections.
2. Developing new synthetic routes for the compound.
3. Exploring its potential applications in material science and nanoscience.
4. Studying its potential as a tool in biological and biochemical research.
5. Developing new click chemistry reactions utilizing 6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose.
6. Improving methods for its analysis and characterization.
Conclusion:
6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranoseuranose is a compound that has attracted attention in various fields of scientific research due to its unique properties and potential applications. Its physical and chemical properties, biological activity, and synthetic versatility make it a valuable tool in organic synthesis, drug discovery, and materials science. Future research will continue to explore its potential as a tool in scientific research and industry.
CAS Number | 126210-25-1 |
Product Name | 6-Azido-6-deoxy-2,3-O-isopropylidene-alpha-L-sorbofuranose |
IUPAC Name | (3aS,5S,6S,6aR)-5-(azidomethyl)-3a-(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
Molecular Formula | C₉H₁₅N₃O₅ |
Molecular Weight | 245.23 |
InChI | InChI=1S/C9H15N3O5/c1-8(2)16-7-6(14)5(3-11-12-10)15-9(7,4-13)17-8/h5-7,13-14H,3-4H2,1-2H3/t5-,6-,7+,9-/m0/s1 |
SMILES | CC1(OC2C(C(OC2(O1)CO)CN=[N+]=[N-])O)C |
Synonyms | 6-Azido-6-deoxy-2,3-O-(1-methylethylidene)-α-L-sorbofuranose |
CAS No: 126210-25-1 MDL No: MFCD15144924 Chemical Formula: C9H15N3O5 Molecular Weight: 245.23 |
Contact: Miss.Xing
Phone: 18310328607 , 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628