14200-76-1, 6-O-Benzoyl-D-glucose, 
CAS:14200-76-1
C13H16O7 / 284.26
D-Vacciniin belongs to the class of organic compounds known as benzoic acid esters. These are ester derivatives of benzoic acid. D-Vacciniin exists as a solid, soluble (in water), and a very weakly acidic compound (based on its pKa). Outside of the human body, D-vacciniin can be found in fruits. This makes D-vacciniin a potential biomarker for the consumption of this food product.
| CAS Number | 14200-76-1 | 
| Product Name | D-Glucose, 6-benzoate | 
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] benzoate | 
| Molecular Formula | C13H16O7 | 
| Molecular Weight | 284.26 g/mol | 
| InChI | InChI=1S/C13H16O7/c14-6-9(15)11(17)12(18)10(16)7-20-13(19)8-4-2-1-3-5-8/h1-6,9-12,15-18H,7H2/t9-,10+,11+,12+/m0/s1 | 
| InChI Key | MRDRXKCKIMVUHN-HMUNZLOLSA-N | 
| SMILES | C1=CC=C(C=C1)C(=O)OCC(C(C(C(C=O)O)O)O)O | 
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)O)O)O)O | 
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)O)O)O)O | 
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628