176161-24-3 , Maribavir,
CAS:176161-24-3
C15H19Cl2N3O4 / 376.235
Potent antiviral against HCMV and Epstein-Barr virus (EBV)
Maribavir is an orally available benzimidazole riboside compound with activity against cytomegalovirus (CMV). Maribavir is a selective ATP competitor of viral UL97 kinase, which is involved in viral nuclear maturation events, such as viral DNA assembly and movement of viral capsids from the nucleus of infected cells. Maribavir has activity against strains of CMV that are resistant to standard anti-CMV agents.
| CAS Number | 176161-24-3 |
| Product Name | Maribavir |
| IUPAC Name | (2S,3S,4R,5S)-2-[5,6-dichloro-2-(propan-2-ylamino)benzimidazol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| Molecular Formula | C15H19Cl2N3O4 |
| Molecular Weight | 376.235 g/mol |
| InChI | InChI=1S/C15H19Cl2N3O4/c1-6(2)18-15-19-9-3-7(16)8(17)4-10(9)20(15)14-13(23)12(22)11(5-21)24-14/h3-4,6,11-14,21-23H,5H2,1-2H3,(H,18,19)/t11-,12-,13-,14-/m0/s1 |
| InChI Key | KJFBVJALEQWJBS-XUXIUFHCSA-N |
| SMILES | CC(C)NC1=NC2=CC(=C(C=C2N1C3C(C(C(O3)CO)O)O)Cl)Cl |
| Solubility | Soluble in DMSO |
| Synonyms | 1263W94, 5,6-dichloro-2-isopropylamino-1-b-L-ribofuranosyl-1H-benzimidazole, benzimidavir, BW 1263W94, BW-1263W94, GW 1263, GW 257406X, GW-1263, GW-257406X, GW257406X, maribavir |
| Canonical SMILES | CC(C)NC1=NC2=CC(=C(C=C2N1C3C(C(C(O3)CO)O)O)Cl)Cl |
| Isomeric SMILES | CC(C)NC1=NC2=CC(=C(C=C2N1[C@@H]3[C@H]([C@H]([C@@H](O3)CO)O)O)Cl)Cl |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628