Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

3068-32-4 , Acetobromo-α-D-galactose, CAS: 3068-32-4

a-D-Acetobromogalactose
1-Bromo-2,3,4,6-tetra-O-acetyl-a-D-galactopyranose
a-Acetobromo-D-galactose
Cas:3068-32-4
C14H19BrO9 / 411.20
MFCD00063686

溴代半乳糖四乙酸酯 , 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl bromide

Donor for Koenigs-Knorr type galactosylation and other anomeric substitutions,

2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide, also known as GalNAc-α-O-Acetyl, is a chemical compound that belongs to the monosaccharide family. It is used as a building block in the synthesis of complex oligosaccharides and glycoproteins. This compound has been used in various scientific experiments for its unique physical and chemical properties.

Synthesis and Characterization:

2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide can be synthesized through various methods, including chemical synthesis and enzymatic synthesis. During chemical synthesis, the compound is derived from galactose and acetic anhydride. Enzymatic synthesis, on the other hand, involves the use of enzymes to catalyze the synthesis of the compound.

Analytical Methods:

Various analytical methods have been used to determine the properties of 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide. Spectroscopic techniques, including nuclear magnetic resonance (NMR), infrared (IR), and mass spectrometry (MS), have been used to determine the chemical structure of the compound. High-performance liquid chromatography (HPLC) has also been used to identify and quantify the compound.

Biological Properties:

2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide has been shown to exhibit biological properties, including anti-inflammatory and anti-tumor activities. Studies have shown that the compound can inhibit the proliferation of various cancer cell lines, including breast cancer and colon cancer cells. It has also been shown to reduce inflammation in animal models.

Toxicity and Safety in Scientific Experiments:

Studies have shown that 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide has low toxicity in animal models. However, caution should be exercised when handling the compound as it can cause irritation to the skin and eyes. Laboratory safety procedures should be followed when working with the compound.

Applications in Scientific Experiments:

2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide has been used in various scientific experiments as a key building block in the synthesis of complex oligosaccharides and glycoproteins. The compound has also been used in drug delivery systems and in the development of anti-tumor agents.

Current State of Research:

Current research on 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide is focused on its potential use as a therapeutic agent for cancer and inflammatory conditions. There is also ongoing research on the development of new and improved methods for the synthesis of the compound.

Potential Implications in Various Fields of Research and Industry:

2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide has potential implications in various fields of research and industry, including drug discovery and development, biomedical research, and biotechnology. The compound can be used in the development of new drugs and therapies for various diseases, including cancer and inflammatory conditions.

Limitations and Future Directions:

One of the limitations of 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide is its low solubility in water. This limits its use in certain applications, such as drug delivery systems. Future research should focus on the development of new methods for increasing the solubility of the compound. Other future directions include the development of new and improved methods for the synthesis of the compound and its derivatives, and further studies to determine its potential therapeutic uses.

In conclusion, 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide is a unique chemical compound with potential implications in various fields of research and industry. Its physical and chemical properties, synthesis and characterization, biological properties, analytical methods, toxicity, safety, and applications have been extensively studied and documented. Further research is needed to fully understand its potential therapeutic uses and to overcome its limitations.


CAS Number3068-32-4
Product Name2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide
IUPAC Name(3,4,5-triacetyloxy-6-bromooxan-2-yl)methyl acetate
Molecular FormulaC₁₄H₁₉BrO₉
Molecular Weight411.2 g/mol
InChIInChI=1S/C14H19BrO9/c1-6(16)20-5-10-11(21-7(2)17)12(22-8(3)18)13(14(15)24-10)23-9(4)19/h10-14H,5H2,1-4H3
InChI KeyCYAYKKUWALRRPA-UHFFFAOYSA-N
SMILESCC(=O)OCC1C(C(C(C(O1)Br)OC(=O)C)OC(=O)C)OC(=O)C
SynonymsAcetobromo-α-D-Galactose; Acetobromogalactose;
Canonical SMILESCC(=O)OCC1C(C(C(C(O1)Br)OC(=O)C)OC(=O)C)OC(=O)C
Isomeric SMILESCC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)Br)OC(=O)C)OC(=O)C)OC(=O)C


CAS No: 3068-32-4 Synonyms: a-D-Acetobromogalactose1-Bromo-2,3,4,6-tetra-O-acetyl-a-D-galactopyranosea-Acetobromo-D-galactose MDL No: MFCD00063686 Chemical Formula: C14H19BrO9 Molecular Weight: 411.20

COA:

2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl Bromide; Acetobromo-alpha-D-galactose

M.F.: C14H19BrO9                      M.W.: 411.20                        CAS: 3068-32-4

Items

Standards

Results

Appearance

White crystal powder

Complies

Solubility

Insoluble in water, soluble in ether

Complies

NMR and MS

Should comply

Complies

Identification

IR and HPLC

Complies

M.P.

80℃ ~ 85℃

83℃ -85℃

Loss weight on drying

Max.0.5%

0.1%

[α]20/D (in CHCl3)

+ 215o ~ +220o

+ 217.6o

Any other impurity

Max. 2%

Complies

Assay by TLC

Should be one spot

Complies

Assay by HPLC

Min. 95%

98.4%

References:

1. Matta KL, Barlow JJ, Carbohydr. Res. 1976, 48, p65-71

INQUIRY

Scan the qr codeClose
the qr code