3615-55-2 ,D-Ribose-5-phosphate,
CAS:3615-55-2
C5H11O8P / 230.11
MFCD00149349
D-核糖-5-磷酸
Aldehydo-D-ribose 5-phosphate is the acyclic form of D-ribose 5-phosphate. It is a conjugate acid of an aldehydo-D-ribose 5-phosphate(2-).
| CAS Number | 3615-55-2 |
| Product Name | Ribose-5-phosphate |
| IUPAC Name | [(2R,3R,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate |
| Molecular Formula | C5H11O8P |
| Molecular Weight | 230.11 g/mol |
| InChI | InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h1,3-5,7-9H,2H2,(H2,10,11,12)/t3-,4+,5-/m0/s1 |
| InChI Key | PPQRONHOSHZGFQ-LMVFSUKVSA-N |
| SMILES | C(C(C(C(C=O)O)O)O)OP(=O)(O)O |
| Synonyms | D-ribose 5-phosphate, D-ribose-5-phosphoric acid, ribose 5-monophosphate, ribose 5-phosphate, ribose phosphate, ribose-5-phosphate, ribose-5-phosphoric acid, ribose-5-phosphoric acid, (D-ribofuranose)-isomer, ribose-5-phosphoric acid, (D-ribose)-isomer, ribose-5-phosphoric acid, monobarium salt, (D-ribose)-isomer, ribose-5-phosphoric acid, monosodium salt, (D-ribose)-isomer |
| Canonical SMILES | C(C(C(C(C=O)O)O)O)OP(=O)(O)O |
| Isomeric SMILES | C([C@H]([C@H]([C@H](C=O)O)O)O)OP(=O)(O)O |
| CAS No: 207671-46-3,3615-55-2,18265-46-8 MDL No: MFCD00149349 Chemical Formula: C5H11O8P Molecular Weight: 230.11 |
| References: 1. Kolb VM, Dworkin JP, Miller SL, J. Mol. Evolution 1994, Vol38, No6, p549-557 |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628