55658-87-2,3-Deoxy-D-arabinose,CAS:55658-87-2
C5H10O4 / 134.13
3-Deoxy-D-arabinose is a sugar that is synthesized by the biochemical process of de novo synthesis. It is a structural component of glycoproteins and lipopolysaccharides, which are essential for bacterial growth. 3-Deoxy-D-arabinose is also used in the regulation of gene expression. The efficient method for its production was discovered by enzymatic dehydrogenation of glucose with the enzyme dehydrogenase, which is encoded by corynebacterium glutamicum. This discovery has led to an unraveling of the wild-type strain's metabolic pathways.
| CAS Number | 55658-87-2 |
| Product Name | (2S,4S)-2,4,5-trihydroxypentanal |
| IUPAC Name | (2S,4S)-2,4,5-trihydroxypentanal |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| InChI | InChI=1S/C5H10O4/c6-2-4(8)1-5(9)3-7/h2,4-5,7-9H,1,3H2/t4-,5-/m0/s1 |
| InChI Key | GKHJPQPGKIAEJO-WHFBIAKZSA-N |
| SMILES | C(C(CO)O)C(C=O)O |
| Canonical SMILES | C(C(CO)O)C(C=O)O |
| Isomeric SMILES | C([C@@H](CO)O)[C@@H](C=O)O |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628