642-00-2, Hexa-O-acetyl-D-mannitol, 
CAS:642-00-2
C18H26O12 / 434.39
MFCD00067461
1, 2, 3, 4, 5, 6-Hexa-O-acetyl-D-mannitol (1,2,3,4,5,6-HOM) is a glycoside that belongs to the group of pentose sugars. It is the only natural hexose sugar that contains an acetate residue in its structure. 1,2,3,4,5,6-HOM is found in plants and animals and has been shown to have anti-cancer properties. The reaction products of 1 with various enzymes are also studied for their cancer inhibitory effects. This molecule has also been shown to inhibit lipid peroxidation in mitochondria. 1,2,3,4,5,6-HOM binds to cell surface receptors on cancer cells and inhibits growth by inhibiting the synthesis of DNA and RNA.
| CAS Number | 642-00-2 | 
| Product Name | Hexa-O-acetyl-D-mannitol | 
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexyl] acetate | 
| Molecular Formula | C18H26O12 | 
| Molecular Weight | 434.39 g/mol | 
| InChI | InChI=1S/C18H26O12/c1-9(19)25-7-15(27-11(3)21)17(29-13(5)23)18(30-14(6)24)16(28-12(4)22)8-26-10(2)20/h15-18H,7-8H2,1-6H3/t15-,16-,17-,18-/m1/s1 | 
| InChI Key | NJVBTKVPPOFGAT-BRSBDYLESA-N | 
| SMILES | CC(=O)OCC(C(C(C(COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C | 
| Synonyms | Hexa-O-acetyl-D-mannitol, Hexaacetyl mannitol | 
| Canonical SMILES | CC(=O)OCC(C(C(C(COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C | 
| Isomeric SMILES | CC(=O)OC[C@H]([C@H]([C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C | 
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628