113890-34-9 2-Deoxy-alpha-L-erythro-pentopyranose,CAS:113890-34-9
C5H10O4 / 134.13
MFCD08705377
| CAS Number | 113890-34-9 |
| Product Name | 2-Deoxy-alpha-L-erythro-pentopyranose |
| IUPAC Name | (2R,4R,5S)-oxane-2,4,5-triol |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| InChI | InChI=1S/C5H10O4/c6-3-1-5(8)9-2-4(3)7/h3-8H,1-2H2/t3-,4+,5-/m1/s1 |
| InChI Key | ZVQAVWAHRUNNPG-MROZADKFSA-N |
| SMILES | C1C(C(COC1O)O)O |
| Canonical SMILES | C1C(C(COC1O)O)O |
| Isomeric SMILES | C1[C@H]([C@H](CO[C@H]1O)O)O |
Name: 2-Deoxy-alpha-L-erythro-pentopyranose CAS: 113890-34-9
M.F.: C5H10O4 M.W.: 134.13 Batch No: 20120323 Quantity: 247g
Items | Standards | Results |
Appearance | White power | Positive |
Solubility | Readily soluble in water and insoluble in ether | Positive |
NMR and MS | Should comply | Complies |
Identification | IR and TLC | Positive |
TLC | One spot | Complies |
Assay (HPLC) | Min. 98% | 99.6% |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628