129787-67-3 ,
5-Bromo-4-chloro-3-indolyl b-D-mannopyranoside,
X-Mannose,
C14H15BrClNO6 / 408.63
MFCD07779478
5-Bromo-4-Chloro-3-Indolyl b-D-Mannopyranoside, also known as X-Man, is an enzyme substrate commonly used for detecting mannosidase enzymes. Upon hydrolysis by the enzyme, it produces a blue-green colored compound that can be detected visually or measured spectrophotometrically. This substrate is useful in characterizing the activity of mannosidases involved in glycoprotein processing and quality control.
| CAS Number | 129787-67-3 |
| Product Name | (2S,3S,4S,5S,6R)-2-((5-Bromo-4-chloro-1H-indol-3-yl)oxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
| IUPAC Name | (2S,3S,4S,5S,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C14H15BrClNO6 |
| Molecular Weight | 408.63 g/mol |
| InChI | InChI=1S/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11-,12+,13+,14-/m1/s1 |
| InChI Key | OPIFSICVWOWJMJ-YRSIJOKUSA-N |
| SMILES | C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)CO)O)O)O)Cl)Br |
| Canonical SMILES | C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)CO)O)O)O)Cl)Br |
| Isomeric SMILES | C1=CC(=C(C2=C1NC=C2O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)Cl)Br |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628