125328-84-9 ,
5-Bromo-4-chloro-3-indolyl b-L-fucopyranoside,
X-b-L-Fucoside,
C14H15BrClNO5 / 392.63
MFCD00063688
5-Bromo-4-chloro-3-indolyl β-L-fucopyranoside (X-Fuc) is a chromogenic substrate specifically designed for the identification and detection of fucosidase enzyme activity. Upon cleavage by fucosidase, it generates a blue-colored 5-Bromo-4-chloro-3-hydroxy-indole precipitate, which can be easily observed under a microscope or spectrophotometer. This feature makes X-Fuc an invaluable tool across various applications, such as biochemical analysis, histochemical staining, cell biology, and enzyme kinetic assays. By providing a fast, sensitive, and reliable readout for fucosidase activity, 5-Bromo-4-chloro-3-indolyl β-L-fucopyranoside facilitates essential research in the understanding of biological processes and the development of therapeutic interventions.
| CAS Number | 125328-84-9 |
| Product Name | 5-Bromo-4-chloro-3-indoxyl-beta-L-fucopyranoside |
| IUPAC Name | (2R,3S,4R,5S,6S)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-methyloxane-3,4,5-triol |
| Molecular Formula | C14H15BrClNO5 |
| Molecular Weight | 392.63 |
| InChI | InChI=1S/C14H15BrClNO5/c1-5-11(18)12(19)13(20)14(21-5)22-8-4-17-7-3-2-6(15)10(16)9(7)8/h2-5,11-14,17-20H,1H3/t5-,11+,12+,13-,14+/m0/s1 |
| InChI Key | ZMYJTGDNFZJYFN-FAKBCLHFSA-N |
| SMILES | CC1C(C(C(C(O1)OC2=CNC3=C2C(=C(C=C3)Br)Cl)O)O)O |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628