14984-34-0 ,Sodium-D-glucuronate,
CAS:14984-34-0
C6H9NaO7·H2O / 234.14
MFCD00135616
D-葡萄糖醛酸钠
Sodium glucuronate is an organic molecular entity.
A sugar acid formed by the oxidation of the C-6 carbon of GLUCOSE. In addition to being a key intermediate metabolite of the uronic acid pathway, glucuronic acid also plays a role in the detoxification of certain drugs and toxins by conjugating with them to form GLUCURONIDES.
| CAS Number | 14984-34-0 |
| Product Name | Sodium glucuronate |
| IUPAC Name | sodium;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| Molecular Formula | C6H9NaO7 |
| Molecular Weight | 216.12 |
| InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h1-5,8-11H,(H,12,13);/q;+1/p-1/t2-,3+,4-,5-;/m0./s1 |
| SMILES | C(=O)C(C(C(C(C(=O)[O-])O)O)O)O.[Na+] |
| CAS No: 207300-70-7,14984-34-0,7182-77-6 Synonyms: D-Glucuronic acid sodium saltD-Glucuronic acid sodium salt monohydrate MDL No: MFCD00135616 Chemical Formula: C6H9NaO7·H2O Molecular Weight: 234.14 |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628