Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

221257-06-3 , 7,4'-Di-O-methylapigenin 5-O-xylosylglucoside

221257-06-3 , 7,4'-Di-O-methylapigenin 5-O-xylosylglucoside
Cas:221257-06-3
C28H32O14 / 592.54
MFCD28988657

7,4'-Di-O-methylapigenin 5-O-xylosylglucoside

7,4'-Di-O-methylapigenin 5-O-xylosylglucoside is a natural product with a high purity that can be used as an analytical reference material for quality control. It has been isolated from the plant and has many bioactive properties. 7,4'-Di-O-methylapigenin 5-O-xylosylglucoside is a secondary metabolite that has been shown to have antifungal, antiinflammatory, and anticancer activities. This compound can also be used in research and development to study the secondary metabolism of plants.

‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ is a flavonoid compound extracted from natural sources such as olive oil, wine and medicinal plants. It has been studied extensively for its potential therapeutic applications in various fields of research and industry. This paper will focus on the definition, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations and future directions.

Definition and Background

‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ is a flavonol glycoside compound composed of apigenin as an aglycone and xylosylglucose as a sugar moiety. It is found in several plants, including olives, olive oil, wine, and medicinal plants such as Salvia miltiorrhiza and Scutellaria baicalensis. The compound has shown potential as a therapeutic agent due to its antioxidant, anti-inflammatory, and neuroprotective properties.

Synthesis and Characterization

The synthesis of ‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ can be achieved through the enzymatic hydrolysis of the naturally occurring compound, scutellarein 4'-O-glucoside, by an enzyme called flavonol 3-O-glycoside 2'''-O-xylosyltransferase. The product can be characterized through various analytical methods such as nuclear magnetic resonance (NMR), high-performance liquid chromatography (HPLC), and mass spectrometry (MS).

Analytical Methods

Analytical methods such as NMR, HPLC, and MS are used to identify and quantify ‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ in various samples. NMR provides information about the molecular structure and composition of the compound, while HPLC and MS are used for quantitative analysis of the compound.

Biological Properties

‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ has shown potential as a therapeutic agent due to its many biological properties. It exhibits antioxidant, anti-inflammatory, and neuroprotective effects. It has also been found to have antimicrobial and antitumor properties.

Toxicity and Safety in Scientific Experiments

Although ‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ has shown potential therapeutic effects, studies have shown that it may have toxic effects when administered in high doses. It is important to determine the maximum safe dosage of the compound in order to avoid toxicity.

Applications in Scientific Experiments

‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ has been used in various scientific experiments due to its many potential therapeutic applications. It has been found to have antioxidant, anti-inflammatory, and neuroprotective effects, which make it a potential therapeutic agent for various diseases such as Alzheimer’s disease, Parkinson’s disease, and cancer.

Current State of Research

Research on ‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ is ongoing, and new potential therapeutic applications of the compound are being discovered. Studies are being conducted to determine the compound’s potential therapeutic effects on various diseases, including cancer, neurodegenerative diseases, and cardiovascular diseases.

Potential Implications in Various Fields of Research and Industry

‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ has potential implications in various fields of research and industry. It can be used as a therapeutic agent in the pharmaceutical industry, as it has potential applications in the treatment of various diseases. It can also be used in the food industry, as it has antioxidant properties that can extend the shelf life of food products.

Limitations and Future Directions

Despite the potential therapeutic applications of ‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’, there are still limitations to the compound’s use. The compound’s toxicity needs to be further studied in order to determine the maximum safe dosage for humans. Future studies should also focus on the compound’s efficacy in different disease models and its potential for interactions with other drugs.

Future Directions

There are several future directions for research on ‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’. These include:

1. Determining the potential therapeutic effects of the compound on different types of cancer.

2. Studying the potential interactions between the compound and other drugs.

3. Investigating the potential of the compound as a therapeutic agent for cardiovascular diseases.

4. Determining the optimal dosage of the compound for different disease models.

5. Studying the compound’s bioavailability and pharmacokinetics in humans.

6. Investigating the impact of processing and storage on the compound’s stability and efficacy.

7. Exploring the potential of the compound as a natural preservative for food products.

Conclusion

‘7,4'-Di-O-methylapigenin 5-O-xylosylglucoside’ is a flavonoid compound with potential therapeutic applications in various fields of research and industry. Despite the compound’s many potential benefits, further research is needed to determine its maximum safe dosage and efficacy in different disease models. Future research should focus on the compound’s potential interactions with other drugs, its bioavailability and pharmacokinetics in humans, and its potential as a natural preservative for food products.

CAS Number221257-06-3
Product Name7,4'-Di-O-methylapigenin 5-O-xylosylglucoside
IUPAC Name7-methoxy-2-(4-methoxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
Molecular FormulaC28H32O14
Molecular Weight592.54 g/mol
InChIInChI=1S/C28H32O14/c1-36-13-5-3-12(4-6-13)17-9-15(29)21-18(40-17)7-14(37-2)8-19(21)41-28-26(35)24(33)23(32)20(42-28)11-39-27-25(34)22(31)16(30)10-38-27/h3-9,16,20,22-28,30-35H,10-11H2,1-2H3/t16-,20-,22+,23-,24+,25-,26-,27+,28-/m1/s1
InChI KeyZTYIRUZJISZADH-AQLOEVPPSA-N
SMILESCOC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O)OC
Canonical SMILESCOC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O)OC
Isomeric SMILESCOC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O)O)O)OC


INQUIRY

Scan the qr codeClose
the qr code