2639-52-3 , 2-Nitrophenyl laurate ,2-Nitrophenyl dodecanoate,
Cas:2639-52-3
C18H27NO4 / 321.41
MFCD00056101
2-Nitrophenyl laurate is a fatty acid that is not able to be degraded and has a high affinity for magnetic particles. It can be used in the immobilization of bacteria, such as Stenotrophomonas maltophilia, which are resistant to many antibiotics. 2-Nitrophenyl laurate also inhibits the enzyme lipolytic enzymes, which are responsible for the degradation of phospholipids in the cell membrane. This inhibition may lead to an increase in bacterial susceptibility to antibiotics. 2-Nitrophenyl laurate is a synthetic substrate that can be used to study the regulation of lipolytic enzymes by regulatory proteins.
| CAS Number | 2639-52-3 |
| Product Name | 2-Nitrophenyl laurate |
| IUPAC Name | (2-nitrophenyl) dodecanoate |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.41 g/mol |
| InChI | InChI=1S/C18H27NO4/c1-2-3-4-5-6-7-8-9-10-15-18(20)23-17-14-12-11-13-16(17)19(21)22/h11-14H,2-10,15H2,1H3 |
| InChI Key | CLUAHXANKUFFPC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCC(=O)OC1=CC=CC=C1[N+](=O)[O-] |
| Canonical SMILES | CCCCCCCCCCCC(=O)OC1=CC=CC=C1[N+](=O)[O-] |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628