30725-00-9,2,3-O-Isopropylidene-D-ribonic gamma-lactone,
CAS: 30725-00-9
C8H12O5 / 188.18
MFCD00080793
2,3-O-Isopropylidene-D-ribonic acid-1,4-lactone is an organic compound that belongs to the class of lactones. It is a chiral molecule with two asymmetric carbons and four stereogenic atoms. This compound can be used for the synthesis of optically active compounds. It is also a precursor for the synthesis of morpholines and phosphonates. 2,3-O-Isopropylidene-D-ribonic acid-1,4-lactone can be synthesized by reacting an enolate with an aldehyde in the presence of a base and acid catalyst. The acid catalyst causes elimination of water from the enolate to produce the desired product.
| CAS Number | 30725-00-9 |
| Product Name | (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyldihydrofuro[3,4-d][1,3]dioxol-4(3aH)-one |
| IUPAC Name | (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| InChI | InChI=1S/C8H12O5/c1-8(2)12-5-4(3-9)11-7(10)6(5)13-8/h4-6,9H,3H2,1-2H3/t4-,5-,6-/m1/s1 |
| InChI Key | NHHKFJCWLPPNCN-HSUXUTPPSA-N |
| SMILES | CC1(OC2C(OC(=O)C2O1)CO)C |
| Canonical SMILES | CC1(OC2C(OC(=O)C2O1)CO)C |
| Isomeric SMILES | CC1(O[C@@H]2[C@H](OC(=O)[C@@H]2O1)CO)C |
| CAS No: 30725-00-9 Synonyms: 2,3-O-Isopropylidene-D-ribonic acid y lactoneD-Ribonolactone monoacetonide2,3-O-Isopropylidene-D-ribonolactone MDL No: MFCD00080793 Chemical Formula: C8H12O5 Molecular Weight: 188.18 |
| References: 1. Shiozaki M, Carbohydr. Res. 2002, Vol337, No21, p2077-2088 |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628