32388-21-9, Oxazinomycin,
CAS:32388-21-9
C9H11NO7 / 245.186
MFCD01747939
Minimycin is a molecule with a hydroxy group at the 2-position. It has been used as a biological sample to detect viruses and dna templates. Minimycin inhibits the synthesis of protein by hybridizing to the dna template, which prevents the hybridized molecules from undergoing nucleophilic substitutions. Minimycin has shown an inhibitory effect against herpes simplex virus in vitro and in vivo, where it was found to be effective against both wild-type and drug-resistant strains of this virus.
| CAS Number | 32388-21-9 |
| Product Name | Minimycin |
| IUPAC Name | 5-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-oxazine-2,4-dione |
| Molecular Formula | C9H11NO7 |
| Molecular Weight | 245.19 g/mol |
| InChI | InChI=1S/C9H11NO7/c11-1-4-5(12)6(13)7(17-4)3-2-16-9(15)10-8(3)14/h2,4-7,11-13H,1H2,(H,10,14,15)/t4-,5-,6-,7+/m1/s1 |
| InChI Key | REFHNSOTFKKRAI-GBNDHIKLSA-N |
| SMILES | C1=C(C(=O)NC(=O)O1)C2C(C(C(O2)CO)O)O |
| Solubility | Soluble in DMSO |
| Synonyms | 5 beta-d-ribofuranosyl-1,3-oxazin-2,4-dione, minimycin, oxazinomycin |
| Canonical SMILES | C1=C(C(=O)NC(=O)O1)C2C(C(C(O2)CO)O)O |
| Isomeric SMILES | C1=C(C(=O)NC(=O)O1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628