61278-30-6 ,D-Glucaric acid-1,4-lactone,
CAS:61278-30-6
C6H8O7·H2O / 210.14
MFCD00149334
D-Saccharic acid 1,4-lactone monohydrate (DSAL) has an ability to inhibit the activity of β-glucuronidase enzyme. It also potentially inhibits Klotho deglycosylation of excitatory amino acid transporters (EAATs) and peptide transporters (PEPTs).
D-Saccharic acid 1,4-lactone is an inhibitor of β-glucuronidase (IC50 = 45 µM for the human enzyme). It is commonly used as a standard in the development of novel inhibitors of β-glucuronidase. D-Saccharic Acid 1,4-lactone is also used to prevent the cleavage of glucuronides in plasma, serum, or urine by β-glucuronidase in samples.
| CAS Number | 61278-30-6 |
| Product Name | (S)-2-((2S,3R,4R)-3,4-Dihydroxy-5-oxotetrahydrofuran-2-yl)-2-hydroxyacetic acid hydrate |
| IUPAC Name | (2S)-2-[(3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate |
| Molecular Formula | C6H10O8 |
| Molecular Weight | 210.14 g/mol |
| InChI | InChI=1S/C6H8O7.H2O/c7-1-2(8)6(12)13-4(1)3(9)5(10)11;/h1-4,7-9H,(H,10,11);1H2/t1-,2-,3+,4?;/m1./s1 |
| InChI Key | NPFKVZHSFSFLPU-QGBSHYGGSA-N |
| SMILES | C1(C(C(=O)OC1C(C(=O)O)O)O)O.O |
| Synonyms | 1,4-Lactone-D-glucaric Acid Monohydrate; |
| Canonical SMILES | C1(C(C(=O)OC1C(C(=O)O)O)O)O.O |
| Isomeric SMILES | [C@H]1([C@H](C(=O)O[C@@H]1[C@@H](C(=O)O)O)O)O.O |
| CAS No: 61278-30-6 Synonyms: D-SaccharolactoneD-Saccharic acid 1,4-lactone monohydrate MDL No: MFCD00149334 Chemical Formula: C6H8O7·H2O Molecular Weight: 210.14 | white to off-white crystalline powder |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628