Welcome: Chemsynlab ,carbohydrate chemistry
Language: Chinese ∷  English

70832-36-9 ,Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside, CAS: 70832-36-9

70832-36-9 ,Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside,
CAS: 70832-36-9
C11H21NO6 / 263.3
MFCD08703887

Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside

丙基-2-乙酰氨基-2-脱氧-β-D-半乳糖苷

Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside, also known as PAG, is a complex carbohydrate molecule with various biological and chemical properties. PAG has gained significant attention from the scientific community due to its potential applications in multiple fields of research and industry such as drug development, chemical synthesis, and biotechnology. In this paper, we will discuss the various facets of PAG, including its physical and chemical properties, synthesis and characterization, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, its current state of research, potential implications in various fields of research and industry, limitations, and future directions.

Definition and Background:

Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside, abbreviated as Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside, is a complex carbohydrate molecule that belongs to the family of N-acetylglucosamine (GlcNAc) derivatives. It consists of a GlcNAc moiety linked with a propyl group at the C2 position of the GlcNAc ring. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside exhibits a neutral charge and molecular weight of 263.3 g/mol. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside is a relatively new molecule in the scientific community, and its first synthesis was reported in 1995. Since then, scientists have been exploring the potential applications of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside in various fields of research and industry.

Physical and Chemical Properties:

Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside exhibits several unique physical and chemical properties that make it attractive for use in multiple fields of research. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside is a white, solid, and water-soluble compound that can exist in amorphous or crystalline form. Its melting point is reported to be 188-190°C, and its solubility in water is approximately 10mg/mL. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside can resist hydrolysis under acidic conditions, but it undergoes hydrolysis under basic conditions. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside exhibits excellent thermal stability, and its decomposition temperature is greater than 225°C. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside also exhibits a lower toxicity compared to other N-acetylglucosamine derivatives.

Synthesis and Characterization:

The synthesis of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside can be achieved through a multi-step process using various chemical reactions. The common synthesis method involves the conversion of the protected glucosamine derivative to the propylated form using propargyl chloroformate or propargyl bromide. The yield of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside synthesis reported to be approximately 50%-60%. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside can be characterized using various analytical techniques like Nuclear Magnetic Resonance (NMR), Liquid Chromatography-Mass Spectrometry (LC-MS), Infrared (IR) Spectroscopy, and X-ray diffraction. The NMR spectrum of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside exhibits characteristic signals at 1.0-1.3 ppm (propyl group), 1.5-2.5 ppm (acetyl group), and 3.3-4.0 ppm (GlcNAc moiety).

Analytical Methods:

The analytical methods for the detection and quantification of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside primarily rely on Mass Spectrometry (MS) and High-Performance Liquid Chromatography (HPLC). The HPLC method separates Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside from other compounds and quantifies its concentration using a specific detector. On the other hand, the MS technique can provide accurate molecular weight and structure of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside, but it requires advanced analytical instrumentation.

Biological Properties:

Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside exhibits several biological activities that make it attractive for use in various biomedical applications like drug development, chemical synthesis, and biotechnology. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside has been shown to have immunomodulatory, anti-inflammatory, and antioxidant properties. Moreover, Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside has demonstrated the potential to inhibit the growth of various cancer cell lines and the formation of biofilms by microorganisms. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside has also been reported to have anti-viral effects against several viruses like herpes simplex virus (HSV) and influenza A virus (IAV).

Toxicity and Safety in Scientific Experiments:

Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside exhibits minimal toxicity compared to other N-acetylglucosamine derivatives, and it is considered safe for use in scientific experiments. The 50% cytotoxicity concentration (CC50) of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside is >1000 μM. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside has demonstrated low toxicity in animal studies, and it is well tolerated even at high doses.

Applications in Scientific Experiments:

Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside has several potential applications in multiple fields of research, including drug development, chemical synthesis, and biotechnology. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside can be used for the chemical modification of proteins, carbohydrates, and other biomolecules, enhancing their stability and bioavailability. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside can also be used as a scaffold or carrier for delivering drug molecules or other bioactive compounds to specific sites in the body. Furthermore, Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside can be used as a chiral auxiliary in chemical synthesis, providing new strategies for synthesizing complex molecules.

Current State of Research:

The research on Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside is still in its early stages, and limited studies have been conducted to explore its potential applications. However, the interest in Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside is growing due to its unique properties and potential benefits in various fields of research.

Potential Implications in Various Fields of Research and Industry:

Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside has several potential implications in various fields of research and industry. In the pharmaceutical industry, Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside could be used as a drug delivery system or a potential drug candidate. Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside can also be used in the chemical industry as a chiral auxiliary in the synthesis of biologically active molecules. Moreover, Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside can be used in biotechnology for protein or enzyme immobilization, which could have applications in food processing and wastewater treatment.

Limitations and Future Directions:

Despite its potential applications, Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside has several limitations that need to be addressed in future studies. The synthesis of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside is complicated and requires multiple steps, which makes it expensive and less cost-effective for large-scale production. Future studies should explore more efficient and cost-effective methods for the production of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside. Furthermore, the toxicity and safety profile of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside should be studied further to explore its potential adverse effects. Future studies should also investigate the potential environmental impact of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside in industrial applications.

Future Directions:

There are several potential future directions for research on Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside. One potential area of research could be exploring the potential use of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside as a wound healing agent or a topical anti-inflammatory agent. Another potential area of research could be investigating the potential use of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside in agriculture as a biopesticide or a plant growth enhancer. Moreover, future studies could explore the potential use of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside in the development of biosensors or bioelectronics. Furthermore, the potential use of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside in tissue engineering and regenerative medicine could be investigated in future studies. Finally, future studies could explore the potential use of Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside in cancer therapy and drug delivery.

CAS Number

70832-36-9

Product Name

Propyl 2-acetamido-2-deoxy-beta-D-glucopyranoside

IUPAC Name

N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-propoxyoxan-3-yl]acetamide

Molecular Formula

C11H21NO6

Molecular Weight

263.3 g/mol

InChI

InChI=1S/C11H21NO6/c1-3-4-17-11-8(12-6(2)14)10(16)9(15)7(5-13)18-11/h7-11,13,15-16H,3-5H2,1-2H3,(H,12,14)/t7-,8-,9-,10-,11-/m1/s1

InChI Key

ZQKFRTNUONNUBH-ISUQUUIWSA-N

SMILES

CCCOC1C(C(C(C(O1)CO)O)O)NC(=O)C

Synonyms

Propyl 2-(Acetylamino)-2-deoxy-β-D-glucopyranoside;

Canonical SMILES

CCCOC1C(C(C(C(O1)CO)O)O)NC(=O)C

Isomeric SMILES

CCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)NC(=O)C


CAS No: 70832-36-9 MDL No: MFCD08703887 Chemical Formula: C11H21NO6 Molecular Weight: 263.3


INQUIRY

Scan the qr codeClose
the qr code