74513-19-2 , Dodecyl b-D-cellobioside,
Cas:74513-19-2
C24H46O11 / 510.62
MFCD22124157
十二烷基-b-D 纤维二糖苷,
Dodecyl b-D-cellobioside is a surfactant that has been shown to form lamellar phases at low temperatures and high concentrations. It is primarily used as a stabilizer for emulsions, such as in ice cream, where it prevents the separation of fats and water. Dodecyl b-D-cellobioside is also known to be involved in the formation of bilayers, which are made up of one layer of hydrophobic molecules and one layer of hydrophilic molecules. This surfactant can exist as two conformations: a lyotropic phase with short chains (lamellar) or a synthetic phase with long chains (spreading). The lamellar phase is more stable than the synthetic phase because it has more contact with water. The lyotropic phase would be useful in an environment where water is scarce, like in outer space.
| CAS Number | 74513-19-2 |
| Product Name | Dodecyl beta-d-cellobioside |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-6-dodecoxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C24H46O11 |
| Molecular Weight | 510.62 g/mol |
| InChI | InChI=1S/C24H46O11/c1-2-3-4-5-6-7-8-9-10-11-12-32-23-21(31)19(29)22(16(14-26)34-23)35-24-20(30)18(28)17(27)15(13-25)33-24/h15-31H,2-14H2,1H3/t15-,16-,17-,18+,19-,20-,21-,22-,23-,24+/m1/s1 |
| InChI Key | NLEBIOOXCVAHBD-ALYNCGSASA-N |
| SMILES | CCCCCCCCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |
| Canonical SMILES | CCCCCCCCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |
| Isomeric SMILES | CCCCCCCCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628