129541-43-1 , 5-Bromo-4-chloro-3-indolyl butyrate
C12H11BrClNO2 / 316.58
MFCD00083261
5-Bromo-4-chloro-3-indoxyl butyrate is a colorimetric substrate used to detect and quantify esterase activity. Upon hydrolysis by esterases, it yields a blue-green dye, allowing the detection and quantification of enzyme activity. It is commonly used in assays for the screening of esterase-producing microorganisms and in research aimed at understanding the role of esterases in various cellular processes.
| CAS Number | 129541-43-1 |
| Product Name | 5-Bromo-4-chloro-3-indolyl butyrate |
| IUPAC Name | (5-bromo-4-chloro-1H-indol-3-yl) butanoate |
| Molecular Formula | C12H11BrClNO2 |
| Molecular Weight | 316.58 g/mol |
| InChI | InChI=1S/C12H11BrClNO2/c1-2-3-10(16)17-9-6-15-8-5-4-7(13)12(14)11(8)9/h4-6,15H,2-3H2,1H3 |
| InChI Key | UKTKOBRRRRODGL-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CNC2=C1C(=C(C=C2)Br)Cl |
| Canonical SMILES | CCCC(=O)OC1=CNC2=C1C(=C(C=C2)Br)Cl |
Contact: Mr.Li
Phone: 13621067991(wechat)
Tel: 13552979007(wechat)
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628