95079-19-9 ,Resorufin b-D-galactopyranoside,
CAS:95079-19-9
C18H17NO8 / 375.33
MFCD00064055
吩噁嗪酮-beta-D-半乳糖苷
Resorufin β-D-galactopyranoside is a compound used for screening and testing purposes in humans. It is commonly used to detect the presence of beta-galactosidase, an enzyme that plays a crucial role in various biological processes. Resorufin β-D-galactopyranoside has inhibitory effects on estrogen receptors and can be used to screen for inhibitors of these receptors. This compound also exhibits fluorescence properties, which can be utilized in imaging applications such as microscopy. Resorufin β-D-galactopyranoside can be incorporated into hydrogels or nanoparticles to enhance its delivery and efficacy. Additionally, this compound has been shown to have active compounds that are effective against bovine serum albumin and planar surfaces.
Resorufin β-D-Galactopyranoside is a fluorogenic substrate for β-galactosidase. Upon enzymatic cleavage by β-galactosidase, the fluorescent moiety resorufin is released and its fluorescence can be used to quantify β-galactosidase activity. Resorufin displays excitation/emission maxima of 570/580 nm, respectively.
CAS Number | 95079-19-9 |
Product Name | Resorufin galactopyranoside |
IUPAC Name | 7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenoxazin-3-one |
Molecular Formula | C18H17NO8 |
Molecular Weight | 375.3 g/mol |
InChI | InChI=1S/C18H17NO8/c20-7-14-15(22)16(23)17(24)18(27-14)25-9-2-4-11-13(6-9)26-12-5-8(21)1-3-10(12)19-11/h1-6,14-18,20,22-24H,7H2/t14-,15+,16+,17-,18-/m1/s1 |
InChI Key | QULZFZMEBOATFS-DISONHOPSA-N |
SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2 |
Solubility | Soluble in DMSO |
Synonyms | resorufin galactopyranoside, resorufin-beta-D-galactopyranoside |
Canonical SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2 |
Isomeric SMILES | C1=CC2=C(C=C1O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)OC4=CC(=O)C=CC4=N2 |
CAS No: 95079-19-9 MDL No: MFCD00064055 Chemical Formula: C18H17NO8 Molecular Weight: 375.33 |
References: 1. Zhang R, Ducy P, Karsenty G, J. Biol. Chem. 1997, Vol272, No1, p110-116 |
Contact: Mr.Li
Phone: 13621067991,13552979007
Tel: 86+10-61274189
Email: chemsynlab@163.com, zhangchao@chemsynlab.com
Add: A411 Room,No.26,Jinyuan Road,Daxing Industrial Developing District,Beijing,China post code:102628